C22H30O3Si — CID 10714242
tert-butyl-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane (PubChem CID 10714242) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is tert-butyl-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10714242 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | tert-butyl-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-diphenylsilane |
| SMILES | CC1(C)OC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H30O3Si/c1-21(2,3)26(19-12-8-6-9-13-19,20-14-10-7-11-15-20)24-17-18-16-23-22(4,5)25-18/h6-15,18H,16-17H2,1-5H3/t18-/m0/s1 |
| InChIKey | IIEWCDRPCONQME-SFHVURJKSA-N |
| XLogP | 3.71 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|