C24H26O3SSi — CID 11373577
(R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-triphenylsilyloxymethanethiol (PubChem CID 11373577) has the molecular formula C24H26O3SSi and a molecular weight of 422.62 g/mol. Its IUPAC name is (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-triphenylsilyloxymethanethiol.
| Compound Name | (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-triphenylsilyloxymethanethiol |
|---|---|
| PubChem CID | 11373577 |
| Molecular Formula | C24H26O3SSi |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | (R)-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-triphenylsilyloxymethanethiol |
| SMILES | CC1(C)OC[C@H]([C@@H](S)O[Si](c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C24H26O3SSi/c1-24(2)25-18-22(26-24)23(28)27-29(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-23,28H,18H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | IWJLIMDYYDSYQI-DHIUTWEWSA-N |
| XLogP | 3.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|