C23H32O3Si — CID 135021097
tert-butyl-diphenyl-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methoxy]silane (PubChem CID 135021097) has the molecular formula C23H32O3Si and a molecular weight of 384.59 g/mol. Its IUPAC name is tert-butyl-diphenyl-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methoxy]silane.
| Compound Name | tert-butyl-diphenyl-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methoxy]silane |
|---|---|
| PubChem CID | 135021097 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | tert-butyl-diphenyl-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methoxy]silane |
| SMILES | C[C@H]1OC(C)(C)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32O3Si/c1-18-21(26-23(5,6)25-18)17-24-27(22(2,3)4,19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16,18,21H,17H2,1-6H3/t18-,21-/m1/s1 |
| InChIKey | QXMMHQVZZACYTG-WIYYLYMNSA-N |
| XLogP | 4.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|