C24H34O2S2Si — CID 10366316
[2-(3,3-diethoxypropyl)-1,3-dithian-2-yl]-methyl-diphenylsilane (PubChem CID 10366316) has the molecular formula C24H34O2S2Si and a molecular weight of 446.75 g/mol. Its IUPAC name is [2-(3,3-diethoxypropyl)-1,3-dithian-2-yl]-methyl-diphenylsilane.
| Compound Name | [2-(3,3-diethoxypropyl)-1,3-dithian-2-yl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 10366316 |
| Molecular Formula | C24H34O2S2Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [2-(3,3-diethoxypropyl)-1,3-dithian-2-yl]-methyl-diphenylsilane |
| SMILES | CCOC(CCC1([Si](C)(c2ccccc2)c2ccccc2)SCCCS1)OCC |
| InChI | InChI=1S/C24H34O2S2Si/c1-4-25-23(26-5-2)17-18-24(27-19-12-20-28-24)29(3,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-11,13-16,23H,4-5,12,17-20H2,1-3H3 |
| InChIKey | YXBHQWVQCFYXIA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|