C29H44O4S2Si — CID 56839247
tert-butyl-[(2S,4R)-5-(2-deuterio-1,3-dithian-2-yl)-2-(ethoxymethoxy)-4-methoxypentoxy]-diphenylsilane (PubChem CID 56839247) has the molecular formula C29H44O4S2Si and a molecular weight of 549.89 g/mol. Its IUPAC name is tert-butyl-[(2S,4R)-5-(2-deuterio-1,3-dithian-2-yl)-2-(ethoxymethoxy)-4-methoxypentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,4R)-5-(2-deuterio-1,3-dithian-2-yl)-2-(ethoxymethoxy)-4-methoxypentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 56839247 |
| Molecular Formula | C29H44O4S2Si |
| Molecular Weight | 549.89 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | tert-butyl-[(2S,4R)-5-(2-deuterio-1,3-dithian-2-yl)-2-(ethoxymethoxy)-4-methoxypentoxy]-diphenylsilane |
| SMILES | [2H]C1(C[C@@H](C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OCOCC)OC)SCCCS1 |
| InChI | InChI=1S/C29H44O4S2Si/c1-6-31-23-32-25(20-24(30-5)21-28-34-18-13-19-35-28)22-33-36(29(2,3)4,26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-12,14-17,24-25,28H,6,13,18-23H2,1-5H3/t24-,25+/m1/s1/i28D |
| InChIKey | JVYBCLQLEXSGPJ-DWGMZVQQSA-N |
| XLogP | 5.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|