C26H36O4S2Si — CID 134937485
(2S,3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dithian-2-yl)-2-methoxyoxolan-3-ol (PubChem CID 134937485) has the molecular formula C26H36O4S2Si and a molecular weight of 504.79 g/mol. Its IUPAC name is (2S,3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dithian-2-yl)-2-methoxyoxolan-3-ol.
| Compound Name | (2S,3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dithian-2-yl)-2-methoxyoxolan-3-ol |
|---|---|
| PubChem CID | 134937485 |
| Molecular Formula | C26H36O4S2Si |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (2S,3S,4S,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(1,3-dithian-2-yl)-2-methoxyoxolan-3-ol |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C2SCCCS2)[C@@H]1O |
| InChI | InChI=1S/C26H36O4S2Si/c1-26(2,3)33(19-12-7-5-8-13-19,20-14-9-6-10-15-20)29-18-21-22(23(27)24(28-4)30-21)25-31-16-11-17-32-25/h5-10,12-15,21-25,27H,11,16-18H2,1-4H3/t21-,22-,23+,24+/m1/s1 |
| InChIKey | LZANDCCUFVDVFX-LWSSLDFYSA-N |
| XLogP | 4.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|