C28H42O4Si — CID 11583642
(2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(oxan-2-yloxymethyl)hexan-2-ol (PubChem CID 11583642) has the molecular formula C28H42O4Si and a molecular weight of 470.73 g/mol. Its IUPAC name is (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(oxan-2-yloxymethyl)hexan-2-ol.
| Compound Name | (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(oxan-2-yloxymethyl)hexan-2-ol |
|---|---|
| PubChem CID | 11583642 |
| Molecular Formula | C28H42O4Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (2R,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-(oxan-2-yloxymethyl)hexan-2-ol |
| SMILES | CCC[C@H](COC1CCCCO1)[C@@H](O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H42O4Si/c1-5-14-23(21-31-27-19-12-13-20-30-27)26(29)22-32-33(28(2,3)4,24-15-8-6-9-16-24)25-17-10-7-11-18-25/h6-11,15-18,23,26-27,29H,5,12-14,19-22H2,1-4H3/t23-,26+,27?/m1/s1 |
| InChIKey | WLYXDCSXIRWHRP-KSFIVCTKSA-N |
| XLogP | 4.88 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|