C24H32O2S2Si — CID 11037628
tert-butyl-[[(7R,9S)-9-methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-yl]oxy]-diphenylsilane (PubChem CID 11037628) has the molecular formula C24H32O2S2Si and a molecular weight of 444.74 g/mol. Its IUPAC name is tert-butyl-[[(7R,9S)-9-methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(7R,9S)-9-methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 11037628 |
| Molecular Formula | C24H32O2S2Si |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | tert-butyl-[[(7R,9S)-9-methyl-8-oxa-1,4-dithiaspiro[4.5]decan-7-yl]oxy]-diphenylsilane |
| SMILES | C[C@H]1CC2(C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O1)SCCS2 |
| InChI | InChI=1S/C24H32O2S2Si/c1-19-17-24(27-15-16-28-24)18-22(25-19)26-29(23(2,3)4,20-11-7-5-8-12-20)21-13-9-6-10-14-21/h5-14,19,22H,15-18H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | HPPVVWZDTVVBHK-SIKLNZKXSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|