C28H42O4S2Si — CID 56839679
(2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-(ethoxymethoxy)pentan-2-ol (PubChem CID 56839679) has the molecular formula C28H42O4S2Si and a molecular weight of 534.86 g/mol. Its IUPAC name is (2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-(ethoxymethoxy)pentan-2-ol.
| Compound Name | (2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-(ethoxymethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 56839679 |
| Molecular Formula | C28H42O4S2Si |
| Molecular Weight | 534.86 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (2S,4S)-5-[tert-butyl(diphenyl)silyl]oxy-1-(1,3-dithian-2-yl)-4-(ethoxymethoxy)pentan-2-ol |
| SMILES | CCOCO[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](O)CC1SCCCS1 |
| InChI | InChI=1S/C28H42O4S2Si/c1-5-30-22-31-24(19-23(29)20-27-33-17-12-18-34-27)21-32-35(28(2,3)4,25-13-8-6-9-14-25)26-15-10-7-11-16-26/h6-11,13-16,23-24,27,29H,5,12,17-22H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | FWAOVMAGHCSRPJ-ZEQRLZLVSA-N |
| XLogP | 5.28 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|