C26H52O3SSi3 — CID 153427677
6-[2-[[dimethyl-(3-methyl-1-phenylpentyl)silyl]oxy-methyl-trimethylsilyloxysilyl]ethylsulfanyl]hexan-1-ol (PubChem CID 153427677) has the molecular formula C26H52O3SSi3 and a molecular weight of 529.02 g/mol. Its IUPAC name is 6-[2-[[dimethyl-(3-methyl-1-phenylpentyl)silyl]oxy-methyl-trimethylsilyloxysilyl]ethylsulfanyl]hexan-1-ol.
| Compound Name | 6-[2-[[dimethyl-(3-methyl-1-phenylpentyl)silyl]oxy-methyl-trimethylsilyloxysilyl]ethylsulfanyl]hexan-1-ol |
|---|---|
| PubChem CID | 153427677 |
| Molecular Formula | C26H52O3SSi3 |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.29 |
| IUPAC Name | 6-[2-[[dimethyl-(3-methyl-1-phenylpentyl)silyl]oxy-methyl-trimethylsilyloxysilyl]ethylsulfanyl]hexan-1-ol |
| SMILES | CCC(C)CC(c1ccccc1)[Si](C)(C)O[Si](C)(CCSCCCCCCO)O[Si](C)(C)C |
| InChI | InChI=1S/C26H52O3SSi3/c1-9-24(2)23-26(25-17-13-12-14-18-25)32(6,7)29-33(8,28-31(3,4)5)22-21-30-20-16-11-10-15-19-27/h12-14,17-18,24,26-27H,9-11,15-16,19-23H2,1-8H3 |
| InChIKey | VJBNHMYFIFOBEL-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|