C34H52O3SSi2 — CID 10077261
tert-butyl-[(1S)-1-[(2S)-3-(3,4-dihydro-2H-thiopyran-6-yl)-2-(2-trimethylsilylethoxymethoxy)propyl]but-3-enoxy]-diphenylsilane (PubChem CID 10077261) has the molecular formula C34H52O3SSi2 and a molecular weight of 597.03 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2S)-3-(3,4-dihydro-2H-thiopyran-6-yl)-2-(2-trimethylsilylethoxymethoxy)propyl]but-3-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2S)-3-(3,4-dihydro-2H-thiopyran-6-yl)-2-(2-trimethylsilylethoxymethoxy)propyl]but-3-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10077261 |
| Molecular Formula | C34H52O3SSi2 |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2S)-3-(3,4-dihydro-2H-thiopyran-6-yl)-2-(2-trimethylsilylethoxymethoxy)propyl]but-3-enoxy]-diphenylsilane |
| SMILES | C=CC[C@@H](C[C@@H](CC1=CCCCS1)OCOCC[Si](C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H52O3SSi2/c1-8-17-29(26-30(27-31-18-15-16-24-38-31)36-28-35-23-25-39(5,6)7)37-40(34(2,3)4,32-19-11-9-12-20-32)33-21-13-10-14-22-33/h8-14,18-22,29-30H,1,15-17,23-28H2,2-7H3/t29-,30-/m0/s1 |
| InChIKey | HBIPFMPEJUQTSQ-KYJUHHDHSA-N |
| XLogP | 8.40 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|