C28H38OSSi — CID 10049458
tert-butyl-[(5E)-5-(butylsulfanylmethylidene)-4-methylcyclohex-3-en-1-yl]oxy-diphenylsilane (PubChem CID 10049458) has the molecular formula C28H38OSSi and a molecular weight of 450.76 g/mol. Its IUPAC name is tert-butyl-[(5E)-5-(butylsulfanylmethylidene)-4-methylcyclohex-3-en-1-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(5E)-5-(butylsulfanylmethylidene)-4-methylcyclohex-3-en-1-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 10049458 |
| Molecular Formula | C28H38OSSi |
| Molecular Weight | 450.76 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | tert-butyl-[(5E)-5-(butylsulfanylmethylidene)-4-methylcyclohex-3-en-1-yl]oxy-diphenylsilane |
| SMILES | CCCCS/C=C1\CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC=C1C |
| InChI | InChI=1S/C28H38OSSi/c1-6-7-20-30-22-24-21-25(19-18-23(24)2)29-31(28(3,4)5,26-14-10-8-11-15-26)27-16-12-9-13-17-27/h8-18,22,25H,6-7,19-21H2,1-5H3/b24-22+ |
| InChIKey | XISWGDPEGJHTAA-ZNTNEXAZSA-N |
| XLogP | 7.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.76 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|