C28H38O2SSi — CID 10004761
(2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(3,4-dihydro-2H-thiopyran-6-yl)hept-6-en-2-ol (PubChem CID 10004761) has the molecular formula C28H38O2SSi and a molecular weight of 466.76 g/mol. Its IUPAC name is (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(3,4-dihydro-2H-thiopyran-6-yl)hept-6-en-2-ol.
| Compound Name | (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(3,4-dihydro-2H-thiopyran-6-yl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 10004761 |
| Molecular Formula | C28H38O2SSi |
| Molecular Weight | 466.76 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (2S,4S)-4-[tert-butyl(diphenyl)silyl]oxy-1-(3,4-dihydro-2H-thiopyran-6-yl)hept-6-en-2-ol |
| SMILES | C=CC[C@@H](C[C@H](O)CC1=CCCCS1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38O2SSi/c1-5-14-24(21-23(29)22-25-15-12-13-20-31-25)30-32(28(2,3)4,26-16-8-6-9-17-26)27-18-10-7-11-19-27/h5-11,15-19,23-24,29H,1,12-14,20-22H2,2-4H3/t23-,24-/m0/s1 |
| InChIKey | BCZHERYSSTWTEM-ZEQRLZLVSA-N |
| XLogP | 6.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|