C34H48O3SSi — CID 10460547
tert-butyl-[(4R,5S,6S)-5-(methoxymethoxy)-4,6-dimethyl-8-phenylsulfanyloctoxy]-diphenylsilane (PubChem CID 10460547) has the molecular formula C34H48O3SSi and a molecular weight of 564.91 g/mol. Its IUPAC name is tert-butyl-[(4R,5S,6S)-5-(methoxymethoxy)-4,6-dimethyl-8-phenylsulfanyloctoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4R,5S,6S)-5-(methoxymethoxy)-4,6-dimethyl-8-phenylsulfanyloctoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10460547 |
| Molecular Formula | C34H48O3SSi |
| Molecular Weight | 564.91 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | tert-butyl-[(4R,5S,6S)-5-(methoxymethoxy)-4,6-dimethyl-8-phenylsulfanyloctoxy]-diphenylsilane |
| SMILES | COCO[C@@H]([C@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CCSc1ccccc1 |
| InChI | InChI=1S/C34H48O3SSi/c1-28(33(36-27-35-6)29(2)24-26-38-30-18-10-7-11-19-30)17-16-25-37-39(34(3,4)5,31-20-12-8-13-21-31)32-22-14-9-15-23-32/h7-15,18-23,28-29,33H,16-17,24-27H2,1-6H3/t28-,29+,33+/m1/s1 |
| InChIKey | VFUZLZFFGANCGA-NCXRXOCASA-N |
| XLogP | 7.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.91 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|