C41H56O7SSi — CID 135066935
3-[(2S,5R,7R)-2-[2-(benzenesulfinyl)ethoxy]-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]propoxy-tert-butyl-diphenylsilane (PubChem CID 135066935) has the molecular formula C41H56O7SSi and a molecular weight of 721.05 g/mol. Its IUPAC name is 3-[(2S,5R,7R)-2-[2-(benzenesulfinyl)ethoxy]-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]propoxy-tert-butyl-diphenylsilane.
| Compound Name | 3-[(2S,5R,7R)-2-[2-(benzenesulfinyl)ethoxy]-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]propoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 135066935 |
| Molecular Formula | C41H56O7SSi |
| Molecular Weight | 721.05 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | 3-[(2S,5R,7R)-2-[2-(benzenesulfinyl)ethoxy]-7-(methoxymethoxy)-5-(methoxymethoxymethyl)-3,3a,4,5,6,7-hexahydro-2H-inden-1-yl]propoxy-tert-butyl-diphenylsilane |
| SMILES | COCOC[C@@H]1CC2C[C@H](OCCS(=O)c3ccccc3)C(CCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)=C2[C@H](OCOC)C1 |
| InChI | InChI=1S/C41H56O7SSi/c1-41(2,3)50(35-18-11-7-12-19-35,36-20-13-8-14-21-36)48-23-15-22-37-38(46-24-25-49(42)34-16-9-6-10-17-34)28-33-26-32(29-45-30-43-4)27-39(40(33)37)47-31-44-5/h6-14,16-21,32-33,38-39H,15,22-31H2,1-5H3/t32-,33?,38+,39-,49?/m1/s1 |
| InChIKey | KUHPOUMNWATNNR-BCSZXFNQSA-N |
| XLogP | 6.87 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.05 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|