C33H52O5SSi — CID 11966399
[(3aS,5aS,6R,9aS,9bR)-5-[(1S)-1-(benzenesulfonyl)but-3-enyl]-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11966399) has the molecular formula C33H52O5SSi and a molecular weight of 588.93 g/mol. Its IUPAC name is [(3aS,5aS,6R,9aS,9bR)-5-[(1S)-1-(benzenesulfonyl)but-3-enyl]-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,5aS,6R,9aS,9bR)-5-[(1S)-1-(benzenesulfonyl)but-3-enyl]-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11966399 |
| Molecular Formula | C33H52O5SSi |
| Molecular Weight | 588.93 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | [(3aS,5aS,6R,9aS,9bR)-5-[(1S)-1-(benzenesulfonyl)but-3-enyl]-2,2,4,5a,9,9-hexamethyl-3a,6,7,8,9a,9b-hexahydrobenzo[g][1,3]benzodioxol-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC[C@@H](C1=C(C)[C@@H]2OC(C)(C)O[C@@H]2[C@H]2C(C)(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]12C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C33H52O5SSi/c1-13-17-24(39(34,35)23-18-15-14-16-19-23)26-22(2)27-28(37-32(8,9)36-27)29-31(6,7)21-20-25(33(26,29)10)38-40(11,12)30(3,4)5/h13-16,18-19,24-25,27-29H,1,17,20-21H2,2-12H3/t24-,25+,27-,28-,29-,33+/m0/s1 |
| InChIKey | FPTQVSSTVBJFGT-MMFITKNOSA-N |
| XLogP | 8.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.93 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|