C40H74O9SSi2 — CID 10898068
(2S,5R)-4-(benzenesulfonyl)-2,5-bis[(4S,5S)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-ol (PubChem CID 10898068) has the molecular formula C40H74O9SSi2 and a molecular weight of 787.26 g/mol. Its IUPAC name is (2S,5R)-4-(benzenesulfonyl)-2,5-bis[(4S,5S)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-ol.
| Compound Name | (2S,5R)-4-(benzenesulfonyl)-2,5-bis[(4S,5S)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-ol |
|---|---|
| PubChem CID | 10898068 |
| Molecular Formula | C40H74O9SSi2 |
| Molecular Weight | 787.26 g/mol |
| Exact Mass | 786.46 |
| IUPAC Name | (2S,5R)-4-(benzenesulfonyl)-2,5-bis[(4S,5S)-5-[(2S)-1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-ol |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]1[C@@H](C)C(O)C([C@H](C)[C@@H]1OC(C)(C)O[C@H]1[C@@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C40H74O9SSi2/c1-26(24-44-51(15,16)37(5,6)7)32-34(48-39(11,12)46-32)28(3)31(41)36(50(42,43)30-22-20-19-21-23-30)29(4)35-33(47-40(13,14)49-35)27(2)25-45-52(17,18)38(8,9)10/h19-23,26-29,31-36,41H,24-25H2,1-18H3/t26-,27-,28-,29+,31?,32-,33-,34-,35-,36?/m0/s1 |
| InChIKey | QXQPBWCDRUNVOF-OASGPSSYSA-N |
| XLogP | 8.82 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.26 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|