C28H48O4SSi — CID 56958713
[(1S,2S,4aR,6S,8aR)-1-[2-(benzenesulfonyl)ethyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl]methanol (PubChem CID 56958713) has the molecular formula C28H48O4SSi and a molecular weight of 508.84 g/mol. Its IUPAC name is [(1S,2S,4aR,6S,8aR)-1-[2-(benzenesulfonyl)ethyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl]methanol.
| Compound Name | [(1S,2S,4aR,6S,8aR)-1-[2-(benzenesulfonyl)ethyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl]methanol |
|---|---|
| PubChem CID | 56958713 |
| Molecular Formula | C28H48O4SSi |
| Molecular Weight | 508.84 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | [(1S,2S,4aR,6S,8aR)-1-[2-(benzenesulfonyl)ethyl]-6-[tert-butyl(dimethyl)silyl]oxy-5,5,8a-trimethyl-1,2,3,4,4a,6,7,8-octahydronaphthalen-2-yl]methanol |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@@H](CCS(=O)(=O)c3ccccc3)[C@@H](CO)CC[C@@H]12 |
| InChI | InChI=1S/C28H48O4SSi/c1-26(2,3)34(7,8)32-25-16-18-28(6)23(21(20-29)14-15-24(28)27(25,4)5)17-19-33(30,31)22-12-10-9-11-13-22/h9-13,21,23-25,29H,14-20H2,1-8H3/t21-,23+,24+,25+,28-/m1/s1 |
| InChIKey | YRUZHPAQUPSQJC-IZRCBWFOSA-N |
| XLogP | 6.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.84 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|