C27H44O5SSi — CID 100916860
(1S,2R,4aR,5R)-4-(benzenesulfonylmethyl)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalene-1,2-diol (PubChem CID 100916860) has the molecular formula C27H44O5SSi and a molecular weight of 508.80 g/mol. Its IUPAC name is (1S,2R,4aR,5R)-4-(benzenesulfonylmethyl)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalene-1,2-diol.
| Compound Name | (1S,2R,4aR,5R)-4-(benzenesulfonylmethyl)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalene-1,2-diol |
|---|---|
| PubChem CID | 100916860 |
| Molecular Formula | C27H44O5SSi |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | (1S,2R,4aR,5R)-4-(benzenesulfonylmethyl)-5-[tert-butyl(dimethyl)silyl]oxy-3,4a,8,8-tetramethyl-1,2,5,6,7,8a-hexahydronaphthalene-1,2-diol |
| SMILES | CC1=C(CS(=O)(=O)c2ccccc2)[C@@]2(C)C([C@H](O)[C@@H]1O)C(C)(C)CC[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H44O5SSi/c1-18-20(17-33(30,31)19-13-11-10-12-14-19)27(7)21(32-34(8,9)25(2,3)4)15-16-26(5,6)24(27)23(29)22(18)28/h10-14,21-24,28-29H,15-17H2,1-9H3/t21-,22-,23-,24?,27-/m1/s1 |
| InChIKey | RTGPJTRTCVALKC-XJDPKPQBSA-N |
| XLogP | 5.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|