C31H48O9SSi — CID 11734828
[(1S,5S,7S,11R,12S,13R,16R)-16-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-4-oxo-13-(phenylmethoxymethyl)-3,8,10-trioxatetracyclo[10.4.0.01,5.07,11]hexadecan-13-yl]methyl methanesulfonate (PubChem CID 11734828) has the molecular formula C31H48O9SSi and a molecular weight of 624.87 g/mol. Its IUPAC name is [(1S,5S,7S,11R,12S,13R,16R)-16-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-4-oxo-13-(phenylmethoxymethyl)-3,8,10-trioxatetracyclo[10.4.0.01,5.07,11]hexadecan-13-yl]methyl methanesulfonate.
| Compound Name | [(1S,5S,7S,11R,12S,13R,16R)-16-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-4-oxo-13-(phenylmethoxymethyl)-3,8,10-trioxatetracyclo[10.4.0.01,5.07,11]hexadecan-13-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11734828 |
| Molecular Formula | C31H48O9SSi |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.28 |
| IUPAC Name | [(1S,5S,7S,11R,12S,13R,16R)-16-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-4-oxo-13-(phenylmethoxymethyl)-3,8,10-trioxatetracyclo[10.4.0.01,5.07,11]hexadecan-13-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@H](C[C@@H]3C(=O)OC[C@@]34[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@](COCc3ccccc3)(COS(C)(=O)=O)[C@H]24)O1 |
| InChI | InChI=1S/C31H48O9SSi/c1-28(2,3)42(7,8)40-24-14-15-30(19-37-41(6,33)34,18-35-17-21-12-10-9-11-13-21)26-25-23(38-29(4,5)39-25)16-22-27(32)36-20-31(22,24)26/h9-13,22-26H,14-20H2,1-8H3/t22-,23+,24-,25+,26+,30-,31+/m1/s1 |
| InChIKey | OJHDAOJUOHOWSA-IWWIGLHXSA-N |
| XLogP | 5.05 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|