C18H26O4 — CID 10425275
(1S,2S,6R,11S,15S)-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadec-7-en-9-one (PubChem CID 10425275) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1S,2S,6R,11S,15S)-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadec-7-en-9-one.
| Compound Name | (1S,2S,6R,11S,15S)-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadec-7-en-9-one |
|---|---|
| PubChem CID | 10425275 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1S,2S,6R,11S,15S)-4,4,7,14,14,15-hexamethyl-3,5,10-trioxatetracyclo[6.6.1.02,6.011,15]pentadec-7-en-9-one |
| SMILES | CC1=C2C(=O)O[C@H]3CCC(C)(C)[C@H]([C@@H]4OC(C)(C)O[C@H]14)[C@@]23C |
| InChI | InChI=1S/C18H26O4/c1-9-11-15(19)20-10-7-8-16(2,3)14(18(10,11)6)13-12(9)21-17(4,5)22-13/h10,12-14H,7-8H2,1-6H3/t10-,12+,13+,14-,18+/m0/s1 |
| InChIKey | ASQLEGXVUGDUKN-TUZUABPUSA-N |
| XLogP | 3.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |