C25H44O4Si — CID 134922709
5-[(1S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5,8a-trimethyl-4-oxo-4a,6,7,8-tetrahydronaphthalen-1-yl]-3-methylpentanal (PubChem CID 134922709) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is 5-[(1S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5,8a-trimethyl-4-oxo-4a,6,7,8-tetrahydronaphthalen-1-yl]-3-methylpentanal.
| Compound Name | 5-[(1S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5,8a-trimethyl-4-oxo-4a,6,7,8-tetrahydronaphthalen-1-yl]-3-methylpentanal |
|---|---|
| PubChem CID | 134922709 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 5-[(1S,4aS,8R,8aS)-8-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-5,5,8a-trimethyl-4-oxo-4a,6,7,8-tetrahydronaphthalen-1-yl]-3-methylpentanal |
| SMILES | CC(CC=O)CC[C@]1(O)C=CC(=O)[C@H]2C(C)(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]21C |
| InChI | InChI=1S/C25H44O4Si/c1-18(13-17-26)10-15-25(28)16-11-19(27)21-23(5,6)14-12-20(24(21,25)7)29-30(8,9)22(2,3)4/h11,16-18,20-21,28H,10,12-15H2,1-9H3/t18?,20-,21+,24-,25+/m1/s1 |
| InChIKey | IFPOTVMOCFMDAX-LHMUIVFFSA-N |
| XLogP | 5.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|