C36H62OSi — CID 554947
tert-butyl-dimethyl-[[7,7,12,16-tetramethyl-15-(5-methylhept-6-yn-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]silane (PubChem CID 554947) has the molecular formula C36H62OSi and a molecular weight of 538.98 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[7,7,12,16-tetramethyl-15-(5-methylhept-6-yn-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[7,7,12,16-tetramethyl-15-(5-methylhept-6-yn-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]silane |
|---|---|
| PubChem CID | 554947 |
| Molecular Formula | C36H62OSi |
| Molecular Weight | 538.98 g/mol |
| Exact Mass | 538.46 |
| IUPAC Name | tert-butyl-dimethyl-[[7,7,12,16-tetramethyl-15-(5-methylhept-6-yn-2-yl)-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]silane |
| SMILES | C#CC(C)CCC(C)C1CCC2(C)C3CCC4C(C)(C)C(O[Si](C)(C)C(C)(C)C)CCC45CC35CCC12C |
| InChI | InChI=1S/C36H62OSi/c1-13-25(2)14-15-26(3)27-18-20-34(10)29-17-16-28-32(7,8)30(37-38(11,12)31(4,5)6)19-21-35(28)24-36(29,35)23-22-33(27,34)9/h1,25-30H,14-24H2,2-12H3 |
| InChIKey | YDCHLDCRKOCVHQ-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.98 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|