C33H56O — CID 101297746
(1S,3R,6S,8R,11S,12S,15R,16R)-6-methoxy-7,7,12,16-tetramethyl-15-[(2R)-5,5,6-trimethylhept-6-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane (PubChem CID 101297746) has the molecular formula C33H56O and a molecular weight of 468.81 g/mol. Its IUPAC name is (1S,3R,6S,8R,11S,12S,15R,16R)-6-methoxy-7,7,12,16-tetramethyl-15-[(2R)-5,5,6-trimethylhept-6-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane.
| Compound Name | (1S,3R,6S,8R,11S,12S,15R,16R)-6-methoxy-7,7,12,16-tetramethyl-15-[(2R)-5,5,6-trimethylhept-6-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
|---|---|
| PubChem CID | 101297746 |
| Molecular Formula | C33H56O |
| Molecular Weight | 468.81 g/mol |
| Exact Mass | 468.43 |
| IUPAC Name | (1S,3R,6S,8R,11S,12S,15R,16R)-6-methoxy-7,7,12,16-tetramethyl-15-[(2R)-5,5,6-trimethylhept-6-en-2-yl]pentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
| SMILES | C=C(C)C(C)(C)CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4C(C)(C)[C@@H](OC)CC[C@@]45C[C@@]35CC[C@]12C |
| InChI | InChI=1S/C33H56O/c1-22(2)28(4,5)16-13-23(3)24-14-17-31(9)26-12-11-25-29(6,7)27(34-10)15-18-32(25)21-33(26,32)20-19-30(24,31)8/h23-27H,1,11-21H2,2-10H3/t23-,24-,25+,26+,27+,30-,31+,32-,33+/m1/s1 |
| InChIKey | VPXGEROVEYWYJI-CQFJJOBKSA-N |
| XLogP | 9.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.81 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|