C34H58O — CID 162854016
15-(4-ethyl-6-methyl-5-methylideneheptan-2-yl)-6-methoxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane (PubChem CID 162854016) has the molecular formula C34H58O and a molecular weight of 482.84 g/mol. Its IUPAC name is 15-(4-ethyl-6-methyl-5-methylideneheptan-2-yl)-6-methoxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane.
| Compound Name | 15-(4-ethyl-6-methyl-5-methylideneheptan-2-yl)-6-methoxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
|---|---|
| PubChem CID | 162854016 |
| Molecular Formula | C34H58O |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.45 |
| IUPAC Name | 15-(4-ethyl-6-methyl-5-methylideneheptan-2-yl)-6-methoxy-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane |
| SMILES | C=C(C(C)C)C(CC)CC(C)C1CCC2(C)C3CCC4C(C)(C)C(OC)CCC45CC35CCC12C |
| InChI | InChI=1S/C34H58O/c1-11-25(24(5)22(2)3)20-23(4)26-14-16-32(9)28-13-12-27-30(6,7)29(35-10)15-17-33(27)21-34(28,33)19-18-31(26,32)8/h22-23,25-29H,5,11-21H2,1-4,6-10H3 |
| InChIKey | NRFWQVFPTVBADN-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|