C31H50O3 — CID 162872595
5-[2-(6-methoxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)propyl]-3-methyloxolan-2-one (PubChem CID 162872595) has the molecular formula C31H50O3 and a molecular weight of 470.74 g/mol. Its IUPAC name is 5-[2-(6-methoxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)propyl]-3-methyloxolan-2-one.
| Compound Name | 5-[2-(6-methoxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)propyl]-3-methyloxolan-2-one |
|---|---|
| PubChem CID | 162872595 |
| Molecular Formula | C31H50O3 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.38 |
| IUPAC Name | 5-[2-(6-methoxy-7,7,12,16-tetramethyl-15-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl)propyl]-3-methyloxolan-2-one |
| SMILES | COC1CCC23CC24CCC2(C)C(C(C)CC5CC(C)C(=O)O5)CCC2(C)C4CCC3C1(C)C |
| InChI | InChI=1S/C31H50O3/c1-19(16-21-17-20(2)26(32)34-21)22-10-12-29(6)24-9-8-23-27(3,4)25(33-7)11-13-30(23)18-31(24,30)15-14-28(22,29)5/h19-25H,8-18H2,1-7H3 |
| InChIKey | CHKLCIOPOJVAIZ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |