C21H34O2Si — CID 102067903
(1S,5S,7R,8S)-7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6,6-dimethyltricyclo[6.3.0.01,5]undeca-2,10-dien-4-one (PubChem CID 102067903) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (1S,5S,7R,8S)-7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6,6-dimethyltricyclo[6.3.0.01,5]undeca-2,10-dien-4-one.
| Compound Name | (1S,5S,7R,8S)-7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6,6-dimethyltricyclo[6.3.0.01,5]undeca-2,10-dien-4-one |
|---|---|
| PubChem CID | 102067903 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1S,5S,7R,8S)-7-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6,6-dimethyltricyclo[6.3.0.01,5]undeca-2,10-dien-4-one |
| SMILES | CC(C)C(C)(C)[Si](C)(C)O[C@@H]1[C@H]2CC=C[C@]23C=CC(=O)[C@@H]3C1(C)C |
| InChI | InChI=1S/C21H34O2Si/c1-14(2)20(5,6)24(7,8)23-18-15-10-9-12-21(15)13-11-16(22)17(21)19(18,3)4/h9,11-15,17-18H,10H2,1-8H3/t15-,17-,18-,21+/m1/s1 |
| InChIKey | BFUHKZVLNDDVMU-FLTJSSMESA-N |
| XLogP | 5.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|