C35H44O5SSi — CID 99771607
[(8R,9S)-8-(benzenesulfonyl)-6,8-dibenzyl-1,4-dioxaspiro[4.5]dec-6-en-9-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 99771607) has the molecular formula C35H44O5SSi and a molecular weight of 604.89 g/mol. Its IUPAC name is [(8R,9S)-8-(benzenesulfonyl)-6,8-dibenzyl-1,4-dioxaspiro[4.5]dec-6-en-9-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(8R,9S)-8-(benzenesulfonyl)-6,8-dibenzyl-1,4-dioxaspiro[4.5]dec-6-en-9-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 99771607 |
| Molecular Formula | C35H44O5SSi |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | [(8R,9S)-8-(benzenesulfonyl)-6,8-dibenzyl-1,4-dioxaspiro[4.5]dec-6-en-9-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1CC2(OCCO2)C(Cc2ccccc2)=C[C@@]1(Cc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H44O5SSi/c1-33(2,3)42(4,5)40-27-31-26-35(38-21-22-39-35)30(23-28-15-9-6-10-16-28)25-34(31,24-29-17-11-7-12-18-29)41(36,37)32-19-13-8-14-20-32/h6-20,25,31H,21-24,26-27H2,1-5H3/t31-,34+/m0/s1 |
| InChIKey | SPULGTDHJKKOPW-AFPLUKJUSA-N |
| XLogP | 7.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|