C41H54O6SSi — CID 10439732
(3S,5S,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-ol (PubChem CID 10439732) has the molecular formula C41H54O6SSi and a molecular weight of 703.03 g/mol. Its IUPAC name is (3S,5S,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-ol.
| Compound Name | (3S,5S,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-ol |
|---|---|
| PubChem CID | 10439732 |
| Molecular Formula | C41H54O6SSi |
| Molecular Weight | 703.03 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | (3S,5S,7S)-9-[tert-butyl(diphenyl)silyl]oxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-ol |
| SMILES | COCO[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](C[C@H](O)CC(Sc1ccccc1)c1ccccc1)OCOC |
| InChI | InChI=1S/C41H54O6SSi/c1-41(2,3)49(38-22-14-8-15-23-38,39-24-16-9-17-25-39)47-27-26-35(45-31-43-4)30-36(46-32-44-5)28-34(42)29-40(33-18-10-6-11-19-33)48-37-20-12-7-13-21-37/h6-25,34-36,40,42H,26-32H2,1-5H3/t34-,35-,36-,40?/m0/s1 |
| InChIKey | VUKSGSVBRARPHS-QEKFDDAZSA-N |
| XLogP | 8.00 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.03 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|