C27H38O7S — CID 11755925
[(3S,5R,7S)-9-hydroxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-yl] acetate (PubChem CID 11755925) has the molecular formula C27H38O7S and a molecular weight of 506.66 g/mol. Its IUPAC name is [(3S,5R,7S)-9-hydroxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-yl] acetate.
| Compound Name | [(3S,5R,7S)-9-hydroxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-yl] acetate |
|---|---|
| PubChem CID | 11755925 |
| Molecular Formula | C27H38O7S |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(3S,5R,7S)-9-hydroxy-5,7-bis(methoxymethoxy)-1-phenyl-1-phenylsulfanylnonan-3-yl] acetate |
| SMILES | COCO[C@H](C[C@H](CCO)OCOC)C[C@@H](CC(Sc1ccccc1)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C27H38O7S/c1-21(29)34-25(17-24(33-20-31-3)16-23(14-15-28)32-19-30-2)18-27(22-10-6-4-7-11-22)35-26-12-8-5-9-13-26/h4-13,23-25,27-28H,14-20H2,1-3H3/t23-,24+,25-,27?/m0/s1 |
| InChIKey | XKCTXHDPMKAQMV-MVHAGCGSSA-N |
| XLogP | 4.98 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|