C25H32O4S — CID 57128743
3-(benzenesulfinyl)-8-(oxan-2-yloxy)-1-phenyloct-1-en-4-ol (PubChem CID 57128743) has the molecular formula C25H32O4S and a molecular weight of 428.59 g/mol. Its IUPAC name is 3-(benzenesulfinyl)-8-(oxan-2-yloxy)-1-phenyloct-1-en-4-ol.
| Compound Name | 3-(benzenesulfinyl)-8-(oxan-2-yloxy)-1-phenyloct-1-en-4-ol |
|---|---|
| PubChem CID | 57128743 |
| Molecular Formula | C25H32O4S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-(benzenesulfinyl)-8-(oxan-2-yloxy)-1-phenyloct-1-en-4-ol |
| SMILES | O=S(c1ccccc1)C(C=Cc1ccccc1)C(O)CCCCOC1CCCCO1 |
| InChI | InChI=1S/C25H32O4S/c26-23(15-7-9-19-28-25-16-8-10-20-29-25)24(18-17-21-11-3-1-4-12-21)30(27)22-13-5-2-6-14-22/h1-6,11-14,17-18,23-26H,7-10,15-16,19-20H2 |
| InChIKey | KXCODGQWNSMMQY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|