C32H42O3SSi — CID 11135277
(2R)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propan-1-ol (PubChem CID 11135277) has the molecular formula C32H42O3SSi and a molecular weight of 534.84 g/mol. Its IUPAC name is (2R)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 11135277 |
| Molecular Formula | C32H42O3SSi |
| Molecular Weight | 534.84 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (2R)-2-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]propan-1-ol |
| SMILES | C[C@H](CO)[C@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](Sc2ccccc2)O1 |
| InChI | InChI=1S/C32H42O3SSi/c1-25(24-33)30-22-26(23-31(35-30)36-27-14-8-5-9-15-27)20-21-34-37(32(2,3)4,28-16-10-6-11-17-28)29-18-12-7-13-19-29/h5-19,25-26,30-31,33H,20-24H2,1-4H3/t25-,26-,30-,31+/m1/s1 |
| InChIKey | KZSNAGUTOQUGKO-OSCFFGAZSA-N |
| XLogP | 6.50 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.84 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|