C29H36O5SSi — CID 139261170
(2R,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol (PubChem CID 139261170) has the molecular formula C29H36O5SSi and a molecular weight of 524.76 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 139261170 |
| Molecular Formula | C29H36O5SSi |
| Molecular Weight | 524.76 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(4-methylphenyl)sulfanyloxane-3,4,5-triol |
| SMILES | Cc1ccc(S[C@@H]2O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C29H36O5SSi/c1-20-15-17-21(18-16-20)35-28-27(32)26(31)25(30)24(34-28)19-33-36(29(2,3)4,22-11-7-5-8-12-22)23-13-9-6-10-14-23/h5-18,24-28,30-32H,19H2,1-4H3/t24-,25+,26+,27-,28+/m1/s1 |
| InChIKey | RKWSUZOTMDWCFN-JYIVOWJTSA-N |
| XLogP | 3.47 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.76 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|