C30H40O2SSi — CID 10005889
(2S)-7-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfanylheptan-2-ol (PubChem CID 10005889) has the molecular formula C30H40O2SSi and a molecular weight of 492.80 g/mol. Its IUPAC name is (2S)-7-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfanylheptan-2-ol.
| Compound Name | (2S)-7-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfanylheptan-2-ol |
|---|---|
| PubChem CID | 10005889 |
| Molecular Formula | C30H40O2SSi |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (2S)-7-[tert-butyl(diphenyl)silyl]oxy-1-(4-methylphenyl)sulfanylheptan-2-ol |
| SMILES | Cc1ccc(SC[C@@H](O)CCCCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H40O2SSi/c1-25-19-21-27(22-20-25)33-24-26(31)14-8-7-13-23-32-34(30(2,3)4,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h5-6,9-12,15-22,26,31H,7-8,13-14,23-24H2,1-4H3/t26-/m0/s1 |
| InChIKey | ZDQVRGDJHNNVOZ-SANMLTNESA-N |
| XLogP | 6.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|