C21H20OS — CID 102036491
(1S,2S)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethanol (PubChem CID 102036491) has the molecular formula C21H20OS and a molecular weight of 320.46 g/mol. Its IUPAC name is (1S,2S)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethanol.
| Compound Name | (1S,2S)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethanol |
|---|---|
| PubChem CID | 102036491 |
| Molecular Formula | C21H20OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (1S,2S)-2-(4-methylphenyl)sulfanyl-1,2-diphenylethanol |
| SMILES | Cc1ccc(S[C@@H](c2ccccc2)[C@@H](O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20OS/c1-16-12-14-19(15-13-16)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15,20-22H,1H3/t20-,21-/m0/s1 |
| InChIKey | UWBKGYLPEYWNEJ-SFTDATJTSA-N |
| XLogP | 5.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |