C16H18O2S — CID 134931619
1-(4-methylphenyl)sulfinyl-3-phenylpropan-2-ol (PubChem CID 134931619) has the molecular formula C16H18O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfinyl-3-phenylpropan-2-ol.
| Compound Name | 1-(4-methylphenyl)sulfinyl-3-phenylpropan-2-ol |
|---|---|
| PubChem CID | 134931619 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfinyl-3-phenylpropan-2-ol |
| SMILES | Cc1ccc(S(=O)CC(O)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C16H18O2S/c1-13-7-9-16(10-8-13)19(18)12-15(17)11-14-5-3-2-4-6-14/h2-10,15,17H,11-12H2,1H3 |
| InChIKey | XFEUKQPOTSQLSX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |