C33H40O3SSi — CID 10460055
tert-butyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-diphenylsilane (PubChem CID 10460055) has the molecular formula C33H40O3SSi and a molecular weight of 544.83 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 10460055 |
| Molecular Formula | C33H40O3SSi |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | tert-butyl-[[(2R,3S,6S)-6-ethoxy-2-[(E)-4-phenylsulfanylbut-2-enyl]-3,6-dihydro-2H-pyran-3-yl]oxy]-diphenylsilane |
| SMILES | CCO[C@@H]1C=C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](C/C=C/CSc2ccccc2)O1 |
| InChI | InChI=1S/C33H40O3SSi/c1-5-34-32-25-24-31(30(35-32)23-15-16-26-37-27-17-9-6-10-18-27)36-38(33(2,3)4,28-19-11-7-12-20-28)29-21-13-8-14-22-29/h6-22,24-25,30-32H,5,23,26H2,1-4H3/b16-15+/t30-,31+,32+/m1/s1 |
| InChIKey | NUEDGOLMBRAPAQ-NBEMELKCSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|