C35H42O5SSi — CID 10416185
[(E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate (PubChem CID 10416185) has the molecular formula C35H42O5SSi and a molecular weight of 602.87 g/mol. Its IUPAC name is [(E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate.
| Compound Name | [(E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate |
|---|---|
| PubChem CID | 10416185 |
| Molecular Formula | C35H42O5SSi |
| Molecular Weight | 602.87 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | [(E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-enyl] acetate |
| SMILES | CCO[C@@H]1C=C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]([C@H](/C=C/CSc2ccccc2)OC(C)=O)O1 |
| InChI | InChI=1S/C35H42O5SSi/c1-6-37-33-25-24-32(34(39-33)31(38-27(2)36)23-16-26-41-28-17-10-7-11-18-28)40-42(35(3,4)5,29-19-12-8-13-20-29)30-21-14-9-15-22-30/h7-25,31-34H,6,26H2,1-5H3/b23-16+/t31-,32-,33-,34+/m0/s1 |
| InChIKey | KDTLRAHNAFGUTF-ASXBILEQSA-N |
| XLogP | 6.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.87 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|