C33H40O4SSi — CID 10030719
(E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-en-1-ol (PubChem CID 10030719) has the molecular formula C33H40O4SSi and a molecular weight of 560.83 g/mol. Its IUPAC name is (E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-en-1-ol.
| Compound Name | (E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-en-1-ol |
|---|---|
| PubChem CID | 10030719 |
| Molecular Formula | C33H40O4SSi |
| Molecular Weight | 560.83 g/mol |
| Exact Mass | 560.24 |
| IUPAC Name | (E,1S)-1-[(2R,3S,6S)-3-[tert-butyl(diphenyl)silyl]oxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-4-phenylsulfanylbut-2-en-1-ol |
| SMILES | CCO[C@@H]1C=C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]([C@@H](O)/C=C/CSc2ccccc2)O1 |
| InChI | InChI=1S/C33H40O4SSi/c1-5-35-31-24-23-30(32(36-31)29(34)22-15-25-38-26-16-9-6-10-17-26)37-39(33(2,3)4,27-18-11-7-12-19-27)28-20-13-8-14-21-28/h6-24,29-32,34H,5,25H2,1-4H3/b22-15+/t29-,30-,31-,32+/m0/s1 |
| InChIKey | ORIQRVVREHUUNS-LUKSKNLTSA-N |
| XLogP | 5.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.83 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|