C33H42O4SSi — CID 15953224
(E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-en-1-ol (PubChem CID 15953224) has the molecular formula C33H42O4SSi and a molecular weight of 562.85 g/mol. Its IUPAC name is (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-en-1-ol.
| Compound Name | (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-en-1-ol |
|---|---|
| PubChem CID | 15953224 |
| Molecular Formula | C33H42O4SSi |
| Molecular Weight | 562.85 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | (E,4R)-4-[tert-butyl(diphenyl)silyl]oxy-4-[(2R,4R,6S)-4-methoxy-6-phenylsulfanyloxan-2-yl]-2-methylbut-2-en-1-ol |
| SMILES | CO[C@H]1C[C@H](Sc2ccccc2)O[C@@H]([C@@H](/C=C(\C)CO)O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C33H42O4SSi/c1-25(24-34)21-31(30-22-26(35-5)23-32(36-30)38-27-15-9-6-10-16-27)37-39(33(2,3)4,28-17-11-7-12-18-28)29-19-13-8-14-20-29/h6-21,26,30-32,34H,22-24H2,1-5H3/b25-21+/t26-,30-,31-,32+/m1/s1 |
| InChIKey | KMGRODVLYSXKAM-RTWDNYEKSA-N |
| XLogP | 6.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.85 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|