C35H44O5SSi — CID 11319414
[(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,3-dihydropyran-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane (PubChem CID 11319414) has the molecular formula C35H44O5SSi and a molecular weight of 604.89 g/mol. Its IUPAC name is [(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,3-dihydropyran-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,3-dihydropyran-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11319414 |
| Molecular Formula | C35H44O5SSi |
| Molecular Weight | 604.89 g/mol |
| Exact Mass | 604.27 |
| IUPAC Name | [(E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,3-dihydropyran-2-yl]pent-4-enoxy]-tert-butyl-diphenylsilane |
| SMILES | CO[C@]1(CCS(=O)(=O)c2ccccc2)C=CC[C@@H](/C=C/CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C35H44O5SSi/c1-34(2,3)42(32-22-12-6-13-23-32,33-24-14-7-15-25-33)39-28-16-8-9-18-30-19-17-26-35(38-4,40-30)27-29-41(36,37)31-20-10-5-11-21-31/h5-7,9-15,17-18,20-26,30H,8,16,19,27-29H2,1-4H3/b18-9+/t30-,35-/m1/s1 |
| InChIKey | ONGXPLMTBDYZJQ-DXKUZTSASA-N |
| XLogP | 6.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.89 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|