C27H44O5SSi — CID 134886730
[(E)-4-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]but-3-enoxy]-tri(propan-2-yl)silane (PubChem CID 134886730) has the molecular formula C27H44O5SSi and a molecular weight of 508.80 g/mol. Its IUPAC name is [(E)-4-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]but-3-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E)-4-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]but-3-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134886730 |
| Molecular Formula | C27H44O5SSi |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.27 |
| IUPAC Name | [(E)-4-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]but-3-enoxy]-tri(propan-2-yl)silane |
| SMILES | CO[C@@]1(CCS(=O)(=O)c2ccccc2)CC=C[C@H](/C=C/CCO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C27H44O5SSi/c1-22(2)34(23(3)4,24(5)6)31-20-12-11-14-25-15-13-18-27(30-7,32-25)19-21-33(28,29)26-16-9-8-10-17-26/h8-11,13-17,22-25H,12,18-21H2,1-7H3/b14-11+/t25-,27-/m0/s1 |
| InChIKey | KZLCMWRJGQFQDD-HIUPNADASA-N |
| XLogP | 6.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|