C23H32O6S — CID 134963490
tert-butyl (E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoate (PubChem CID 134963490) has the molecular formula C23H32O6S and a molecular weight of 436.57 g/mol. Its IUPAC name is tert-butyl (E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoate.
| Compound Name | tert-butyl (E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 134963490 |
| Molecular Formula | C23H32O6S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | tert-butyl (E)-5-[(2S,6S)-6-[2-(benzenesulfonyl)ethyl]-6-methoxy-2,5-dihydropyran-2-yl]pent-4-enoate |
| SMILES | CO[C@@]1(CCS(=O)(=O)c2ccccc2)CC=C[C@H](/C=C/CCC(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C23H32O6S/c1-22(2,3)29-21(24)15-9-8-11-19-12-10-16-23(27-4,28-19)17-18-30(25,26)20-13-6-5-7-14-20/h5-8,10-14,19H,9,15-18H2,1-4H3/b11-8+/t19-,23-/m0/s1 |
| InChIKey | CWVJADJOYJJXBI-MBQYDLODSA-N |
| XLogP | 4.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|