C28H40O9S2Si — CID 134882652
[(E,4S)-4-[(2S,3R)-5,5-bis(benzenesulfonyl)-3-trimethylsilyloxypentan-2-yl]oxyhex-2-enyl] methyl carbonate (PubChem CID 134882652) has the molecular formula C28H40O9S2Si and a molecular weight of 612.84 g/mol. Its IUPAC name is [(E,4S)-4-[(2S,3R)-5,5-bis(benzenesulfonyl)-3-trimethylsilyloxypentan-2-yl]oxyhex-2-enyl] methyl carbonate.
| Compound Name | [(E,4S)-4-[(2S,3R)-5,5-bis(benzenesulfonyl)-3-trimethylsilyloxypentan-2-yl]oxyhex-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 134882652 |
| Molecular Formula | C28H40O9S2Si |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | [(E,4S)-4-[(2S,3R)-5,5-bis(benzenesulfonyl)-3-trimethylsilyloxypentan-2-yl]oxyhex-2-enyl] methyl carbonate |
| SMILES | CC[C@@H](/C=C/COC(=O)OC)O[C@@H](C)[C@@H](CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1)O[Si](C)(C)C |
| InChI | InChI=1S/C28H40O9S2Si/c1-7-23(15-14-20-35-28(29)34-3)36-22(2)26(37-40(4,5)6)21-27(38(30,31)24-16-10-8-11-17-24)39(32,33)25-18-12-9-13-19-25/h8-19,22-23,26-27H,7,20-21H2,1-6H3/b15-14+/t22-,23-,26+/m0/s1 |
| InChIKey | JQLKYEDXISCPIX-QAKXJIOYSA-N |
| XLogP | 5.39 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|