C19H22O6S2 — CID 56602044
4-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 56602044) has the molecular formula C19H22O6S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 56602044 |
| Molecular Formula | C19H22O6S2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 4-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CC(S(=O)(=O)c2ccccc2)S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H22O6S2/c1-19(2)24-14-15(25-19)13-18(26(20,21)16-9-5-3-6-10-16)27(22,23)17-11-7-4-8-12-17/h3-12,15,18H,13-14H2,1-2H3 |
| InChIKey | OEHYSHHTHYRLDU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |