C19H20O5S2 — CID 10905266
[1-(benzenesulfonyl)-4-propa-1,2-dienoxybutyl]sulfonylbenzene (PubChem CID 10905266) has the molecular formula C19H20O5S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-4-propa-1,2-dienoxybutyl]sulfonylbenzene.
| Compound Name | [1-(benzenesulfonyl)-4-propa-1,2-dienoxybutyl]sulfonylbenzene |
|---|---|
| PubChem CID | 10905266 |
| Molecular Formula | C19H20O5S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | [1-(benzenesulfonyl)-4-propa-1,2-dienoxybutyl]sulfonylbenzene |
| SMILES | C=C=COCCCC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H20O5S2/c1-2-15-24-16-9-14-19(25(20,21)17-10-5-3-6-11-17)26(22,23)18-12-7-4-8-13-18/h3-8,10-13,15,19H,1,9,14,16H2 |
| InChIKey | SWUQJEAULJICQX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|