C18H20O5S2 — CID 14911920
3-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyloxirane (PubChem CID 14911920) has the molecular formula C18H20O5S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyloxirane.
| Compound Name | 3-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 14911920 |
| Molecular Formula | C18H20O5S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 3-[2,2-bis(benzenesulfonyl)ethyl]-2,2-dimethyloxirane |
| SMILES | CC1(C)OC1CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O5S2/c1-18(2)16(23-18)13-17(24(19,20)14-9-5-3-6-10-14)25(21,22)15-11-7-4-8-12-15/h3-12,16-17H,13H2,1-2H3 |
| InChIKey | RAJCBDHUDJYPGG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|