C22H26O5S2 — CID 134880432
2-[6,6-bis(benzenesulfonyl)hexyl]-3-ethenyloxirane (PubChem CID 134880432) has the molecular formula C22H26O5S2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[6,6-bis(benzenesulfonyl)hexyl]-3-ethenyloxirane.
| Compound Name | 2-[6,6-bis(benzenesulfonyl)hexyl]-3-ethenyloxirane |
|---|---|
| PubChem CID | 134880432 |
| Molecular Formula | C22H26O5S2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[6,6-bis(benzenesulfonyl)hexyl]-3-ethenyloxirane |
| SMILES | C=CC1OC1CCCCCC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H26O5S2/c1-2-20-21(27-20)16-10-5-11-17-22(28(23,24)18-12-6-3-7-13-18)29(25,26)19-14-8-4-9-15-19/h2-4,6-9,12-15,20-22H,1,5,10-11,16-17H2 |
| InChIKey | AUVFHRWKOITTSG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 80.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|