C15H22O3S — CID 134882688
(2S,6S)-2-(benzenesulfonyl)-6-butyloxane (PubChem CID 134882688) has the molecular formula C15H22O3S and a molecular weight of 282.40 g/mol. Its IUPAC name is (2S,6S)-2-(benzenesulfonyl)-6-butyloxane.
| Compound Name | (2S,6S)-2-(benzenesulfonyl)-6-butyloxane |
|---|---|
| PubChem CID | 134882688 |
| Molecular Formula | C15H22O3S |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (2S,6S)-2-(benzenesulfonyl)-6-butyloxane |
| SMILES | CCCC[C@H]1CCC[C@H](S(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C15H22O3S/c1-2-3-8-13-9-7-12-15(18-13)19(16,17)14-10-5-4-6-11-14/h4-6,10-11,13,15H,2-3,7-9,12H2,1H3/t13-,15-/m0/s1 |
| InChIKey | FGTOEGLIRPXUJF-ZFWWWQNUSA-N |
| XLogP | 3.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |