C27H36O5S2 — CID 10918168
(2S,6Z,8S)-4,4-bis(benzenesulfonyl)-8-ethyl-2-hexyl-2,3,5,8-tetrahydrooxocine (PubChem CID 10918168) has the molecular formula C27H36O5S2 and a molecular weight of 504.71 g/mol. Its IUPAC name is (2S,6Z,8S)-4,4-bis(benzenesulfonyl)-8-ethyl-2-hexyl-2,3,5,8-tetrahydrooxocine.
| Compound Name | (2S,6Z,8S)-4,4-bis(benzenesulfonyl)-8-ethyl-2-hexyl-2,3,5,8-tetrahydrooxocine |
|---|---|
| PubChem CID | 10918168 |
| Molecular Formula | C27H36O5S2 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (2S,6Z,8S)-4,4-bis(benzenesulfonyl)-8-ethyl-2-hexyl-2,3,5,8-tetrahydrooxocine |
| SMILES | CCCCCC[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C/C=C\[C@H](CC)O1 |
| InChI | InChI=1S/C27H36O5S2/c1-3-5-6-9-15-24-22-27(21-14-16-23(4-2)32-24,33(28,29)25-17-10-7-11-18-25)34(30,31)26-19-12-8-13-20-26/h7-8,10-14,16-20,23-24H,3-6,9,15,21-22H2,1-2H3/b16-14-/t23-,24-/m0/s1 |
| InChIKey | RFZGBWPDJRPFRT-MZOHPKPJSA-N |
| XLogP | 6.11 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|